C11H10O3 — CID 5483179
7-hydroxy-3,8-dimethylchromen-2-one (PubChem CID 5483179) has the molecular formula C11H10O3 and a molecular weight of 190.20 g/mol. Its IUPAC name is 7-hydroxy-3,8-dimethylchromen-2-one.
| Compound Name | 7-hydroxy-3,8-dimethylchromen-2-one |
|---|---|
| PubChem CID | 5483179 |
| Molecular Formula | C11H10O3 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | 7-hydroxy-3,8-dimethylchromen-2-one |
| SMILES | Cc1cc2ccc(O)c(C)c2oc1=O |
| InChI | InChI=1S/C11H10O3/c1-6-5-8-3-4-9(12)7(2)10(8)14-11(6)13/h3-5,12H,1-2H3 |
| InChIKey | XSMBCOMOENDKHA-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|