C18H15NO5 — CID 87265834
(7-hydroxy-8-methyl-2-oxochromen-3-yl) N-benzylcarbamate (PubChem CID 87265834) has the molecular formula C18H15NO5 and a molecular weight of 325.32 g/mol. Its IUPAC name is (7-hydroxy-8-methyl-2-oxochromen-3-yl) N-benzylcarbamate.
| Compound Name | (7-hydroxy-8-methyl-2-oxochromen-3-yl) N-benzylcarbamate |
|---|---|
| PubChem CID | 87265834 |
| Molecular Formula | C18H15NO5 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | (7-hydroxy-8-methyl-2-oxochromen-3-yl) N-benzylcarbamate |
| SMILES | Cc1c(O)ccc2cc(OC(=O)NCc3ccccc3)c(=O)oc12 |
| InChI | InChI=1S/C18H15NO5/c1-11-14(20)8-7-13-9-15(17(21)24-16(11)13)23-18(22)19-10-12-5-3-2-4-6-12/h2-9,20H,10H2,1H3,(H,19,22) |
| InChIKey | DNGDHASAUBZQIS-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|