(2,4-dimethoxynaphthalen-1-yl) N-benzylcarbamate

C20H19NO4 — CID 19873104

IUPAC(2,4-dimethoxynaphthalen-1-yl) N-benzylcarbamate
SMILESCOc1cc(OC)c2ccccc2c1OC(=O)NCc1ccccc1
InChIInChI=1S/C20H19NO4/c1-23-17-12-18(24-2)19(16-11-7-6-10-15(16)17)25-20(22)21-13-14-8-4-3-5-9-14/h3-12H,13H2,1-2H3,(H,21,22)
InChIKeyHFMPLSUCAFNWOT-UHFFFAOYSA-N
MW337.38 g/mol
LogP4.15
Rot. Bonds5

About (2,4-dimethoxynaphthalen-1-yl) N-benzylcarbamate

(2,4-dimethoxynaphthalen-1-yl) N-benzylcarbamate (PubChem CID 19873104) has the molecular formula C20H19NO4 and a molecular weight of 337.38 g/mol. Its IUPAC name is (2,4-dimethoxynaphthalen-1-yl) N-benzylcarbamate.

Molecular Properties

Compound Name(2,4-dimethoxynaphthalen-1-yl) N-benzylcarbamate
PubChem CID19873104
Molecular FormulaC20H19NO4
Molecular Weight337.38 g/mol
Exact Mass337.13
IUPAC Name(2,4-dimethoxynaphthalen-1-yl) N-benzylcarbamate
SMILESCOc1cc(OC)c2ccccc2c1OC(=O)NCc1ccccc1
InChIInChI=1S/C20H19NO4/c1-23-17-12-18(24-2)19(16-11-7-6-10-15(16)17)25-20(22)21-13-14-8-4-3-5-9-14/h3-12H,13H2,1-2H3,(H,21,22)
InChIKeyHFMPLSUCAFNWOT-UHFFFAOYSA-N
XLogP4.15
TPSA56.79 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms25
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500337.38
LogP ≤ 54.15
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze (2,4-dimethoxynaphthalen-1-yl) N-benzylcarbamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,4-dimethoxynaphthalen-1-yl) N-benzylcarbamate?
The IUPAC name of (2,4-dimethoxynaphthalen-1-yl) N-benzylcarbamate (CID 19873104) is (2,4-dimethoxynaphthalen-1-yl) N-benzylcarbamate.
What is the SMILES notation for (2,4-dimethoxynaphthalen-1-yl) N-benzylcarbamate?
The canonical SMILES for (2,4-dimethoxynaphthalen-1-yl) N-benzylcarbamate is COc1cc(OC)c2ccccc2c1OC(=O)NCc1ccccc1.
What is the InChIKey of (2,4-dimethoxynaphthalen-1-yl) N-benzylcarbamate?
The InChIKey is HFMPLSUCAFNWOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19NO4/c1-23-17-12-18(24-2)19(16-11-7-6-10-15(16)17)25-20(22)21-13-14-8-4-3-5-9-14/h3-12H,13H2,1-2H3,(H,21,22).
What are the key properties of (2,4-dimethoxynaphthalen-1-yl) N-benzylcarbamate?
(2,4-dimethoxynaphthalen-1-yl) N-benzylcarbamate has a molecular weight of 337.38 g/mol, XLogP of 4.15, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dimethoxynaphthalen-1-yl) N-benzylcarbamate is sourced from PubChem (CID 19873104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).