C14H13ClO4 — CID 882078
(3-chloro-4,8-dimethyl-2-oxochromen-7-yl) propanoate (PubChem CID 882078) has the molecular formula C14H13ClO4 and a molecular weight of 280.71 g/mol. Its IUPAC name is (3-chloro-4,8-dimethyl-2-oxochromen-7-yl) propanoate.
| Compound Name | (3-chloro-4,8-dimethyl-2-oxochromen-7-yl) propanoate |
|---|---|
| PubChem CID | 882078 |
| Molecular Formula | C14H13ClO4 |
| Molecular Weight | 280.71 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | (3-chloro-4,8-dimethyl-2-oxochromen-7-yl) propanoate |
| SMILES | CCC(=O)Oc1ccc2c(C)c(Cl)c(=O)oc2c1C |
| InChI | InChI=1S/C14H13ClO4/c1-4-11(16)18-10-6-5-9-7(2)12(15)14(17)19-13(9)8(10)3/h5-6H,4H2,1-3H3 |
| InChIKey | DVDPFUMUVHIWGI-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.71 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|