C22H20O6 — CID 7917092
(4,8-dimethyl-2-oxochromen-7-yl) 2-(4-propanoylphenoxy)acetate (PubChem CID 7917092) has the molecular formula C22H20O6 and a molecular weight of 380.40 g/mol. Its IUPAC name is (4,8-dimethyl-2-oxochromen-7-yl) 2-(4-propanoylphenoxy)acetate.
| Compound Name | (4,8-dimethyl-2-oxochromen-7-yl) 2-(4-propanoylphenoxy)acetate |
|---|---|
| PubChem CID | 7917092 |
| Molecular Formula | C22H20O6 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | (4,8-dimethyl-2-oxochromen-7-yl) 2-(4-propanoylphenoxy)acetate |
| SMILES | CCC(=O)c1ccc(OCC(=O)Oc2ccc3c(C)cc(=O)oc3c2C)cc1 |
| InChI | InChI=1S/C22H20O6/c1-4-18(23)15-5-7-16(8-6-15)26-12-21(25)27-19-10-9-17-13(2)11-20(24)28-22(17)14(19)3/h5-11H,4,12H2,1-3H3 |
| InChIKey | LRCOKATWDWYURP-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 82.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|