C24H14O8 — CID 54448545
4-methoxy-9-[(7-oxofuro[3,2-g]chromen-6-yl)oxymethyl]furo[3,2-g]chromen-7-one (PubChem CID 54448545) has the molecular formula C24H14O8 and a molecular weight of 430.37 g/mol. Its IUPAC name is 4-methoxy-9-[(7-oxofuro[3,2-g]chromen-6-yl)oxymethyl]furo[3,2-g]chromen-7-one.
| Compound Name | 4-methoxy-9-[(7-oxofuro[3,2-g]chromen-6-yl)oxymethyl]furo[3,2-g]chromen-7-one |
|---|---|
| PubChem CID | 54448545 |
| Molecular Formula | C24H14O8 |
| Molecular Weight | 430.37 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | 4-methoxy-9-[(7-oxofuro[3,2-g]chromen-6-yl)oxymethyl]furo[3,2-g]chromen-7-one |
| SMILES | COc1c2ccoc2c(COc2cc3cc4ccoc4cc3oc2=O)c2oc(=O)ccc12 |
| InChI | InChI=1S/C24H14O8/c1-27-21-14-2-3-20(25)32-23(14)16(22-15(21)5-7-29-22)11-30-19-9-13-8-12-4-6-28-17(12)10-18(13)31-24(19)26/h2-10H,11H2,1H3 |
| InChIKey | WTHMMLNITYQYKC-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 105.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.37 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|