C21H22O4 — CID 54222373
6-(2,6-dimethylocta-2,6-dien-4-yloxy)furo[3,2-g]chromen-7-one (PubChem CID 54222373) has the molecular formula C21H22O4 and a molecular weight of 338.40 g/mol. Its IUPAC name is 6-(2,6-dimethylocta-2,6-dien-4-yloxy)furo[3,2-g]chromen-7-one.
| Compound Name | 6-(2,6-dimethylocta-2,6-dien-4-yloxy)furo[3,2-g]chromen-7-one |
|---|---|
| PubChem CID | 54222373 |
| Molecular Formula | C21H22O4 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 6-(2,6-dimethylocta-2,6-dien-4-yloxy)furo[3,2-g]chromen-7-one |
| SMILES | CC=C(C)CC(C=C(C)C)Oc1cc2cc3ccoc3cc2oc1=O |
| InChI | InChI=1S/C21H22O4/c1-5-14(4)9-17(8-13(2)3)24-20-11-16-10-15-6-7-23-18(15)12-19(16)25-21(20)22/h5-8,10-12,17H,9H2,1-4H3 |
| InChIKey | QDMKAERJTVXQSY-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 52.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|