C18H12O7S — CID 12554396
phenyl 9-methoxy-7-oxofuro[3,2-g]chromene-4-sulfonate (PubChem CID 12554396) has the molecular formula C18H12O7S and a molecular weight of 372.35 g/mol. Its IUPAC name is phenyl 9-methoxy-7-oxofuro[3,2-g]chromene-4-sulfonate.
| Compound Name | phenyl 9-methoxy-7-oxofuro[3,2-g]chromene-4-sulfonate |
|---|---|
| PubChem CID | 12554396 |
| Molecular Formula | C18H12O7S |
| Molecular Weight | 372.35 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | phenyl 9-methoxy-7-oxofuro[3,2-g]chromene-4-sulfonate |
| SMILES | COc1c2occc2c(S(=O)(=O)Oc2ccccc2)c2ccc(=O)oc12 |
| InChI | InChI=1S/C18H12O7S/c1-22-17-15-13(9-10-23-15)18(12-7-8-14(19)24-16(12)17)26(20,21)25-11-5-3-2-4-6-11/h2-10H,1H3 |
| InChIKey | DXPNASSGKZOCAS-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 95.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.35 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|