C21H19NO7 — CID 89168174
4-[4-(6-nitrocyclohexa-2,4-dien-1-yl)oxybutoxy]furo[3,2-g]chromen-7-one (PubChem CID 89168174) has the molecular formula C21H19NO7 and a molecular weight of 397.38 g/mol. Its IUPAC name is 4-[4-(6-nitrocyclohexa-2,4-dien-1-yl)oxybutoxy]furo[3,2-g]chromen-7-one.
| Compound Name | 4-[4-(6-nitrocyclohexa-2,4-dien-1-yl)oxybutoxy]furo[3,2-g]chromen-7-one |
|---|---|
| PubChem CID | 89168174 |
| Molecular Formula | C21H19NO7 |
| Molecular Weight | 397.38 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 4-[4-(6-nitrocyclohexa-2,4-dien-1-yl)oxybutoxy]furo[3,2-g]chromen-7-one |
| SMILES | O=c1ccc2c(OCCCCOC3C=CC=CC3[N+](=O)[O-])c3ccoc3cc2o1 |
| InChI | InChI=1S/C21H19NO7/c23-20-8-7-14-19(29-20)13-18-15(9-12-27-18)21(14)28-11-4-3-10-26-17-6-2-1-5-16(17)22(24)25/h1-2,5-9,12-13,16-17H,3-4,10-11H2 |
| InChIKey | DEPPYZVSBJBWPA-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 104.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.38 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|