C25H30O6 — CID 162995563
4-[7-[(1S)-1-ethoxyethoxy]-3,7-dimethylocta-2,5-dienoxy]furo[3,2-g]chromen-7-one (PubChem CID 162995563) has the molecular formula C25H30O6 and a molecular weight of 426.51 g/mol. Its IUPAC name is 4-[7-[(1S)-1-ethoxyethoxy]-3,7-dimethylocta-2,5-dienoxy]furo[3,2-g]chromen-7-one.
| Compound Name | 4-[7-[(1S)-1-ethoxyethoxy]-3,7-dimethylocta-2,5-dienoxy]furo[3,2-g]chromen-7-one |
|---|---|
| PubChem CID | 162995563 |
| Molecular Formula | C25H30O6 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | 4-[7-[(1S)-1-ethoxyethoxy]-3,7-dimethylocta-2,5-dienoxy]furo[3,2-g]chromen-7-one |
| SMILES | CCO[C@H](C)OC(C)(C)C=CCC(C)=CCOc1c2ccoc2cc2oc(=O)ccc12 |
| InChI | InChI=1S/C25H30O6/c1-6-27-18(3)31-25(4,5)13-7-8-17(2)11-14-29-24-19-9-10-23(26)30-22(19)16-21-20(24)12-15-28-21/h7,9-13,15-16,18H,6,8,14H2,1-5H3/t18-/m0/s1 |
| InChIKey | KVOVLZYNXYSDNA-SFHVURJKSA-N |
| XLogP | 5.99 |
| TPSA | 71.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|