C22H30FNO — CID 19960430
4-[2-(2-amino-6-fluorophenyl)ethyl]-2,6-ditert-butylphenol (PubChem CID 19960430) has the molecular formula C22H30FNO and a molecular weight of 343.49 g/mol. Its IUPAC name is 4-[2-(2-amino-6-fluorophenyl)ethyl]-2,6-ditert-butylphenol.
| Compound Name | 4-[2-(2-amino-6-fluorophenyl)ethyl]-2,6-ditert-butylphenol |
|---|---|
| PubChem CID | 19960430 |
| Molecular Formula | C22H30FNO |
| Molecular Weight | 343.49 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | 4-[2-(2-amino-6-fluorophenyl)ethyl]-2,6-ditert-butylphenol |
| SMILES | CC(C)(C)c1cc(CCc2c(N)cccc2F)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C22H30FNO/c1-21(2,3)16-12-14(13-17(20(16)25)22(4,5)6)10-11-15-18(23)8-7-9-19(15)24/h7-9,12-13,25H,10-11,24H2,1-6H3 |
| InChIKey | PHODGCKTILQKKV-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.49 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|