C32H52O2S2Si — CID 19103299
2,6-dibutyl-4-[[(3,5-dibutyl-4-hydroxyphenyl)sulfanylmethyl-dimethylsilyl]methylsulfanyl]phenol (PubChem CID 19103299) has the molecular formula C32H52O2S2Si and a molecular weight of 560.99 g/mol. Its IUPAC name is 2,6-dibutyl-4-[[(3,5-dibutyl-4-hydroxyphenyl)sulfanylmethyl-dimethylsilyl]methylsulfanyl]phenol.
| Compound Name | 2,6-dibutyl-4-[[(3,5-dibutyl-4-hydroxyphenyl)sulfanylmethyl-dimethylsilyl]methylsulfanyl]phenol |
|---|---|
| PubChem CID | 19103299 |
| Molecular Formula | C32H52O2S2Si |
| Molecular Weight | 560.99 g/mol |
| Exact Mass | 560.32 |
| IUPAC Name | 2,6-dibutyl-4-[[(3,5-dibutyl-4-hydroxyphenyl)sulfanylmethyl-dimethylsilyl]methylsulfanyl]phenol |
| SMILES | CCCCc1cc(SC[Si](C)(C)CSc2cc(CCCC)c(O)c(CCCC)c2)cc(CCCC)c1O |
| InChI | InChI=1S/C32H52O2S2Si/c1-7-11-15-25-19-29(20-26(31(25)33)16-12-8-2)35-23-37(5,6)24-36-30-21-27(17-13-9-3)32(34)28(22-30)18-14-10-4/h19-22,33-34H,7-18,23-24H2,1-6H3 |
| InChIKey | PCJJFUKCMIIXSX-UHFFFAOYSA-N |
| XLogP | 10.14 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.99 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|