C19H31BOS — CID 123719361
2,6-dibutyl-4-(4-methylideneboranylbutylsulfanyl)phenol (PubChem CID 123719361) has the molecular formula C19H31BOS and a molecular weight of 318.34 g/mol. Its IUPAC name is 2,6-dibutyl-4-(4-methylideneboranylbutylsulfanyl)phenol.
| Compound Name | 2,6-dibutyl-4-(4-methylideneboranylbutylsulfanyl)phenol |
|---|---|
| PubChem CID | 123719361 |
| Molecular Formula | C19H31BOS |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | 2,6-dibutyl-4-(4-methylideneboranylbutylsulfanyl)phenol |
| SMILES | C=BCCCCSc1cc(CCCC)c(O)c(CCCC)c1 |
| InChI | InChI=1S/C19H31BOS/c1-4-6-10-16-14-18(22-13-9-8-12-20-3)15-17(19(16)21)11-7-5-2/h14-15,21H,3-13H2,1-2H3 |
| InChIKey | SDWVLVDZSQNXAM-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|