C18H22N2O3 — CID 163483131
(3-tert-butyl-4-hydroxy-5-methylphenyl) 3,5-diaminobenzoate (PubChem CID 163483131) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is (3-tert-butyl-4-hydroxy-5-methylphenyl) 3,5-diaminobenzoate.
| Compound Name | (3-tert-butyl-4-hydroxy-5-methylphenyl) 3,5-diaminobenzoate |
|---|---|
| PubChem CID | 163483131 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | (3-tert-butyl-4-hydroxy-5-methylphenyl) 3,5-diaminobenzoate |
| SMILES | Cc1cc(OC(=O)c2cc(N)cc(N)c2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C18H22N2O3/c1-10-5-14(9-15(16(10)21)18(2,3)4)23-17(22)11-6-12(19)8-13(20)7-11/h5-9,21H,19-20H2,1-4H3 |
| InChIKey | CGHDCZGXWYKIHO-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 98.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|