C20H32O2S — CID 129395251
(2R)-2-(3,5-ditert-butylphenyl)sulfanyl-2-methylpentanoic acid (PubChem CID 129395251) has the molecular formula C20H32O2S and a molecular weight of 336.54 g/mol. Its IUPAC name is (2R)-2-(3,5-ditert-butylphenyl)sulfanyl-2-methylpentanoic acid.
| Compound Name | (2R)-2-(3,5-ditert-butylphenyl)sulfanyl-2-methylpentanoic acid |
|---|---|
| PubChem CID | 129395251 |
| Molecular Formula | C20H32O2S |
| Molecular Weight | 336.54 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | (2R)-2-(3,5-ditert-butylphenyl)sulfanyl-2-methylpentanoic acid |
| SMILES | CCC[C@@](C)(Sc1cc(C(C)(C)C)cc(C(C)(C)C)c1)C(=O)O |
| InChI | InChI=1S/C20H32O2S/c1-9-10-20(8,17(21)22)23-16-12-14(18(2,3)4)11-15(13-16)19(5,6)7/h11-13H,9-10H2,1-8H3,(H,21,22)/t20-/m1/s1 |
| InChIKey | AMCZUFIBNJETQH-HXUWFJFHSA-N |
| XLogP | 6.02 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.54 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |