methyl (2R,3R)-3-hydroxy-3-phenyl-2-phenylsulfanylpropanoate

C16H16O3S — CID 10108177

IUPACmethyl (2R,3R)-3-hydroxy-3-phenyl-2-phenylsulfanylpropanoate
SMILESCOC(=O)[C@H](Sc1ccccc1)[C@H](O)c1ccccc1
InChIInChI=1S/C16H16O3S/c1-19-16(18)15(20-13-10-6-3-7-11-13)14(17)12-8-4-2-5-9-12/h2-11,14-15,17H,1H3/t14-,15-/m1/s1
InChIKeyAJNPIYIKMDEFFE-HUUCEWRRSA-N
MW288.37 g/mol
LogP3.05
Rot. Bonds5

About methyl (2R,3R)-3-hydroxy-3-phenyl-2-phenylsulfanylpropanoate

methyl (2R,3R)-3-hydroxy-3-phenyl-2-phenylsulfanylpropanoate (PubChem CID 10108177) has the molecular formula C16H16O3S and a molecular weight of 288.37 g/mol. Its IUPAC name is methyl (2R,3R)-3-hydroxy-3-phenyl-2-phenylsulfanylpropanoate.

Molecular Properties

Compound Namemethyl (2R,3R)-3-hydroxy-3-phenyl-2-phenylsulfanylpropanoate
PubChem CID10108177
Molecular FormulaC16H16O3S
Molecular Weight288.37 g/mol
Exact Mass288.08
IUPAC Namemethyl (2R,3R)-3-hydroxy-3-phenyl-2-phenylsulfanylpropanoate
SMILESCOC(=O)[C@H](Sc1ccccc1)[C@H](O)c1ccccc1
InChIInChI=1S/C16H16O3S/c1-19-16(18)15(20-13-10-6-3-7-11-13)14(17)12-8-4-2-5-9-12/h2-11,14-15,17H,1H3/t14-,15-/m1/s1
InChIKeyAJNPIYIKMDEFFE-HUUCEWRRSA-N
XLogP3.05
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500288.37
LogP ≤ 53.05
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl (2R,3R)-3-hydroxy-3-phenyl-2-phenylsulfanylpropanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (2R,3R)-3-hydroxy-3-phenyl-2-phenylsulfanylpropanoate?
The IUPAC name of methyl (2R,3R)-3-hydroxy-3-phenyl-2-phenylsulfanylpropanoate (CID 10108177) is methyl (2R,3R)-3-hydroxy-3-phenyl-2-phenylsulfanylpropanoate.
What is the SMILES notation for methyl (2R,3R)-3-hydroxy-3-phenyl-2-phenylsulfanylpropanoate?
The canonical SMILES for methyl (2R,3R)-3-hydroxy-3-phenyl-2-phenylsulfanylpropanoate is COC(=O)[C@H](Sc1ccccc1)[C@H](O)c1ccccc1.
What is the InChIKey of methyl (2R,3R)-3-hydroxy-3-phenyl-2-phenylsulfanylpropanoate?
The InChIKey is AJNPIYIKMDEFFE-HUUCEWRRSA-N. The full InChI is InChI=1S/C16H16O3S/c1-19-16(18)15(20-13-10-6-3-7-11-13)14(17)12-8-4-2-5-9-12/h2-11,14-15,17H,1H3/t14-,15-/m1/s1.
What are the key properties of methyl (2R,3R)-3-hydroxy-3-phenyl-2-phenylsulfanylpropanoate?
methyl (2R,3R)-3-hydroxy-3-phenyl-2-phenylsulfanylpropanoate has a molecular weight of 288.37 g/mol, XLogP of 3.05, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R,3R)-3-hydroxy-3-phenyl-2-phenylsulfanylpropanoate is sourced from PubChem (CID 10108177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).