C17H28O3 — CID 101411892
(1S,2R,3S,4S)-2-butyl-1-phenylheptane-1,3,4-triol (PubChem CID 101411892) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is (1S,2R,3S,4S)-2-butyl-1-phenylheptane-1,3,4-triol.
| Compound Name | (1S,2R,3S,4S)-2-butyl-1-phenylheptane-1,3,4-triol |
|---|---|
| PubChem CID | 101411892 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | (1S,2R,3S,4S)-2-butyl-1-phenylheptane-1,3,4-triol |
| SMILES | CCCC[C@@H]([C@H](O)[C@@H](O)CCC)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C17H28O3/c1-3-5-12-14(17(20)15(18)9-4-2)16(19)13-10-7-6-8-11-13/h6-8,10-11,14-20H,3-5,9,12H2,1-2H3/t14-,15+,16-,17+/m1/s1 |
| InChIKey | UYOMUIKQLBLACE-TWMKSMIVSA-N |
| XLogP | 3.05 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |