C14H17BrFNO3 — CID 66631756
tert-butyl N-[1-(5-bromo-2-fluorophenyl)-2-oxopropyl]carbamate (PubChem CID 66631756) has the molecular formula C14H17BrFNO3 and a molecular weight of 346.20 g/mol. Its IUPAC name is tert-butyl N-[1-(5-bromo-2-fluorophenyl)-2-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[1-(5-bromo-2-fluorophenyl)-2-oxopropyl]carbamate |
|---|---|
| PubChem CID | 66631756 |
| Molecular Formula | C14H17BrFNO3 |
| Molecular Weight | 346.20 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | tert-butyl N-[1-(5-bromo-2-fluorophenyl)-2-oxopropyl]carbamate |
| SMILES | CC(=O)C(NC(=O)OC(C)(C)C)c1cc(Br)ccc1F |
| InChI | InChI=1S/C14H17BrFNO3/c1-8(18)12(17-13(19)20-14(2,3)4)10-7-9(15)5-6-11(10)16/h5-7,12H,1-4H3,(H,17,19) |
| InChIKey | YEOVNMGXQUQLCY-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.20 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |