C15H21BrFN3O3 — CID 144651749
tert-butyl N-[N-[1-(5-bromo-2-fluorophenyl)-2-hydroxyethyl]-N'-methylcarbamimidoyl]carbamate (PubChem CID 144651749) has the molecular formula C15H21BrFN3O3 and a molecular weight of 390.25 g/mol. Its IUPAC name is tert-butyl N-[N-[1-(5-bromo-2-fluorophenyl)-2-hydroxyethyl]-N'-methylcarbamimidoyl]carbamate.
| Compound Name | tert-butyl N-[N-[1-(5-bromo-2-fluorophenyl)-2-hydroxyethyl]-N'-methylcarbamimidoyl]carbamate |
|---|---|
| PubChem CID | 144651749 |
| Molecular Formula | C15H21BrFN3O3 |
| Molecular Weight | 390.25 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | tert-butyl N-[N-[1-(5-bromo-2-fluorophenyl)-2-hydroxyethyl]-N'-methylcarbamimidoyl]carbamate |
| SMILES | C/N=C(\NC(=O)OC(C)(C)C)NC(CO)c1cc(Br)ccc1F |
| InChI | InChI=1S/C15H21BrFN3O3/c1-15(2,3)23-14(22)20-13(18-4)19-12(8-21)10-7-9(16)5-6-11(10)17/h5-7,12,21H,8H2,1-4H3,(H2,18,19,20,22) |
| InChIKey | HBIBHOATLGKBTG-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.25 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|