C18H27N3O5 — CID 170266614
3-[(1R)-3-methoxy-1-[[N'-methyl-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]amino]propyl]benzoic acid (PubChem CID 170266614) has the molecular formula C18H27N3O5 and a molecular weight of 365.43 g/mol. Its IUPAC name is 3-[(1R)-3-methoxy-1-[[N'-methyl-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]amino]propyl]benzoic acid.
| Compound Name | 3-[(1R)-3-methoxy-1-[[N'-methyl-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]amino]propyl]benzoic acid |
|---|---|
| PubChem CID | 170266614 |
| Molecular Formula | C18H27N3O5 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | 3-[(1R)-3-methoxy-1-[[N'-methyl-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]amino]propyl]benzoic acid |
| SMILES | C/N=C(\NC(=O)OC(C)(C)C)N[C@H](CCOC)c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C18H27N3O5/c1-18(2,3)26-17(24)21-16(19-4)20-14(9-10-25-5)12-7-6-8-13(11-12)15(22)23/h6-8,11,14H,9-10H2,1-5H3,(H,22,23)(H2,19,20,21,24)/t14-/m1/s1 |
| InChIKey | INAHHWBZRSRXAM-CQSZACIVSA-N |
| XLogP | 2.56 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|