C23H36FNO4Si — CID 72559630
tert-butyl N-[4-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-4-fluorophenyl]but-3-yn-2-yl]carbamate (PubChem CID 72559630) has the molecular formula C23H36FNO4Si and a molecular weight of 437.63 g/mol. Its IUPAC name is tert-butyl N-[4-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-4-fluorophenyl]but-3-yn-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-4-fluorophenyl]but-3-yn-2-yl]carbamate |
|---|---|
| PubChem CID | 72559630 |
| Molecular Formula | C23H36FNO4Si |
| Molecular Weight | 437.63 g/mol |
| Exact Mass | 437.24 |
| IUPAC Name | tert-butyl N-[4-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-4-fluorophenyl]but-3-yn-2-yl]carbamate |
| SMILES | CC(C#Cc1ccc(F)cc1OCCO[Si](C)(C)C(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H36FNO4Si/c1-17(25-21(26)29-22(2,3)4)10-11-18-12-13-19(24)16-20(18)27-14-15-28-30(8,9)23(5,6)7/h12-13,16-17H,14-15H2,1-9H3,(H,25,26) |
| InChIKey | GOQSYTGQXJSMMO-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.63 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|