C23H38N2O4Si — CID 71068168
tert-butyl N-[(2S)-4-[3-[(2R)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]oxy-2-pyridinyl]but-3-yn-2-yl]carbamate (PubChem CID 71068168) has the molecular formula C23H38N2O4Si and a molecular weight of 434.65 g/mol. Its IUPAC name is tert-butyl N-[(2S)-4-[3-[(2R)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]oxy-2-pyridinyl]but-3-yn-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-4-[3-[(2R)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]oxy-2-pyridinyl]but-3-yn-2-yl]carbamate |
|---|---|
| PubChem CID | 71068168 |
| Molecular Formula | C23H38N2O4Si |
| Molecular Weight | 434.65 g/mol |
| Exact Mass | 434.26 |
| IUPAC Name | tert-butyl N-[(2S)-4-[3-[(2R)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]oxy-2-pyridinyl]but-3-yn-2-yl]carbamate |
| SMILES | C[C@H](CO[Si](C)(C)C(C)(C)C)Oc1cccnc1C#C[C@H](C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H38N2O4Si/c1-17(25-21(26)29-22(3,4)5)13-14-19-20(12-11-15-24-19)28-18(2)16-27-30(9,10)23(6,7)8/h11-12,15,17-18H,16H2,1-10H3,(H,25,26)/t17-,18+/m0/s1 |
| InChIKey | FUPIWPGGMSINOY-ZWKOTPCHSA-N |
| XLogP | 5.14 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.65 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|