C22H37NO5Si — CID 58241928
tert-butyl N-[3-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]phenyl]-3-oxopropyl]carbamate (PubChem CID 58241928) has the molecular formula C22H37NO5Si and a molecular weight of 423.63 g/mol. Its IUPAC name is tert-butyl N-[3-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]phenyl]-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]phenyl]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 58241928 |
| Molecular Formula | C22H37NO5Si |
| Molecular Weight | 423.63 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | tert-butyl N-[3-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]phenyl]-3-oxopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(=O)c1ccccc1OCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H37NO5Si/c1-21(2,3)28-20(25)23-14-13-18(24)17-11-9-10-12-19(17)26-15-16-27-29(7,8)22(4,5)6/h9-12H,13-16H2,1-8H3,(H,23,25) |
| InChIKey | IIFHKMOMYUGWET-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.63 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|