C17H28N2O4 — CID 173490592
tert-butyl N-[4-[3-[(2R)-1-hydroxypropan-2-yl]oxy-2-pyridinyl]butan-2-yl]carbamate (PubChem CID 173490592) has the molecular formula C17H28N2O4 and a molecular weight of 324.42 g/mol. Its IUPAC name is tert-butyl N-[4-[3-[(2R)-1-hydroxypropan-2-yl]oxy-2-pyridinyl]butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-[3-[(2R)-1-hydroxypropan-2-yl]oxy-2-pyridinyl]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 173490592 |
| Molecular Formula | C17H28N2O4 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | tert-butyl N-[4-[3-[(2R)-1-hydroxypropan-2-yl]oxy-2-pyridinyl]butan-2-yl]carbamate |
| SMILES | CC(CCc1ncccc1O[C@H](C)CO)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H28N2O4/c1-12(19-16(21)23-17(3,4)5)8-9-14-15(7-6-10-18-14)22-13(2)11-20/h6-7,10,12-13,20H,8-9,11H2,1-5H3,(H,19,21)/t12?,13-/m1/s1 |
| InChIKey | SQMMDBHZTLLKHU-ZGTCLIOFSA-N |
| XLogP | 2.69 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |