C34H42FNO4Si — CID 58242043
9H-fluoren-9-ylmethyl N-[(E,3R)-1-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-4-fluorophenyl]pent-1-en-3-yl]carbamate (PubChem CID 58242043) has the molecular formula C34H42FNO4Si and a molecular weight of 575.80 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(E,3R)-1-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-4-fluorophenyl]pent-1-en-3-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(E,3R)-1-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-4-fluorophenyl]pent-1-en-3-yl]carbamate |
|---|---|
| PubChem CID | 58242043 |
| Molecular Formula | C34H42FNO4Si |
| Molecular Weight | 575.80 g/mol |
| Exact Mass | 575.29 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(E,3R)-1-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-4-fluorophenyl]pent-1-en-3-yl]carbamate |
| SMILES | CC[C@H](/C=C/c1ccc(F)cc1OCCO[Si](C)(C)C(C)(C)C)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C34H42FNO4Si/c1-7-26(19-17-24-16-18-25(35)22-32(24)38-20-21-40-41(5,6)34(2,3)4)36-33(37)39-23-31-29-14-10-8-12-27(29)28-13-9-11-15-30(28)31/h8-19,22,26,31H,7,20-21,23H2,1-6H3,(H,36,37)/b19-17+/t26-/m1/s1 |
| InChIKey | SLWHDYGHXAZEER-WFBCFIKKSA-N |
| XLogP | 8.56 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.80 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|