C18H14BrF6N3O2S — CID 137499166
N-[[(2R,4R)-2-(6-bromo-3-fluoro-2-pyridinyl)-3,3,5,5,5-pentafluoro-4-hydroxypentan-2-yl]carbamothioyl]benzamide (PubChem CID 137499166) has the molecular formula C18H14BrF6N3O2S and a molecular weight of 530.29 g/mol. Its IUPAC name is N-[[(2R,4R)-2-(6-bromo-3-fluoro-2-pyridinyl)-3,3,5,5,5-pentafluoro-4-hydroxypentan-2-yl]carbamothioyl]benzamide.
| Compound Name | N-[[(2R,4R)-2-(6-bromo-3-fluoro-2-pyridinyl)-3,3,5,5,5-pentafluoro-4-hydroxypentan-2-yl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 137499166 |
| Molecular Formula | C18H14BrF6N3O2S |
| Molecular Weight | 530.29 g/mol |
| Exact Mass | 528.99 |
| IUPAC Name | N-[[(2R,4R)-2-(6-bromo-3-fluoro-2-pyridinyl)-3,3,5,5,5-pentafluoro-4-hydroxypentan-2-yl]carbamothioyl]benzamide |
| SMILES | C[C@@](NC(=S)NC(=O)c1ccccc1)(c1nc(Br)ccc1F)C(F)(F)[C@@H](O)C(F)(F)F |
| InChI | InChI=1S/C18H14BrF6N3O2S/c1-16(12-10(20)7-8-11(19)26-12,17(21,22)14(30)18(23,24)25)28-15(31)27-13(29)9-5-3-2-4-6-9/h2-8,14,30H,1H3,(H2,27,28,29,31)/t14-,16-/m1/s1 |
| InChIKey | JWYWEMKWCMIKDA-GDBMZVCRSA-N |
| XLogP | 4.06 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.29 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|