C10H11F2NO2S — CID 170534908
N-(1,1-difluoro-2-methylsulfinylethyl)benzamide (PubChem CID 170534908) has the molecular formula C10H11F2NO2S and a molecular weight of 247.27 g/mol. Its IUPAC name is N-(1,1-difluoro-2-methylsulfinylethyl)benzamide.
| Compound Name | N-(1,1-difluoro-2-methylsulfinylethyl)benzamide |
|---|---|
| PubChem CID | 170534908 |
| Molecular Formula | C10H11F2NO2S |
| Molecular Weight | 247.27 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | N-(1,1-difluoro-2-methylsulfinylethyl)benzamide |
| SMILES | CS(=O)CC(F)(F)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C10H11F2NO2S/c1-16(15)7-10(11,12)13-9(14)8-5-3-2-4-6-8/h2-6H,7H2,1H3,(H,13,14) |
| InChIKey | JATWGRVGVXIHDH-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.27 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|