C15H19F3N2O — CID 10968586
(3E)-3-[tert-butyl(methyl)hydrazinylidene]-1,1,1-trifluoro-3-(4-methylphenyl)propan-2-one (PubChem CID 10968586) has the molecular formula C15H19F3N2O and a molecular weight of 300.32 g/mol. Its IUPAC name is (3E)-3-[tert-butyl(methyl)hydrazinylidene]-1,1,1-trifluoro-3-(4-methylphenyl)propan-2-one.
| Compound Name | (3E)-3-[tert-butyl(methyl)hydrazinylidene]-1,1,1-trifluoro-3-(4-methylphenyl)propan-2-one |
|---|---|
| PubChem CID | 10968586 |
| Molecular Formula | C15H19F3N2O |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | (3E)-3-[tert-butyl(methyl)hydrazinylidene]-1,1,1-trifluoro-3-(4-methylphenyl)propan-2-one |
| SMILES | Cc1ccc(/C(=N\N(C)C(C)(C)C)C(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H19F3N2O/c1-10-6-8-11(9-7-10)12(13(21)15(16,17)18)19-20(5)14(2,3)4/h6-9H,1-5H3/b19-12+ |
| InChIKey | IPESNVDIBKINSA-XDHOZWIPSA-N |
| XLogP | 3.56 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|