C10H8F3NO2 — CID 10681013
(3E)-1,1,1-trifluoro-3-hydroxyimino-3-(4-methylphenyl)propan-2-one (PubChem CID 10681013) has the molecular formula C10H8F3NO2 and a molecular weight of 231.17 g/mol. Its IUPAC name is (3E)-1,1,1-trifluoro-3-hydroxyimino-3-(4-methylphenyl)propan-2-one.
| Compound Name | (3E)-1,1,1-trifluoro-3-hydroxyimino-3-(4-methylphenyl)propan-2-one |
|---|---|
| PubChem CID | 10681013 |
| Molecular Formula | C10H8F3NO2 |
| Molecular Weight | 231.17 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | (3E)-1,1,1-trifluoro-3-hydroxyimino-3-(4-methylphenyl)propan-2-one |
| SMILES | Cc1ccc(/C(=N\O)C(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H8F3NO2/c1-6-2-4-7(5-3-6)8(14-16)9(15)10(11,12)13/h2-5,16H,1H3/b14-8+ |
| InChIKey | CAXKRFZGZCVQGG-RIYZIHGNSA-N |
| XLogP | 2.30 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.17 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|