C17H21F6NOS — CID 154506647
(S)-2-methyl-N-[2,2,2-trifluoro-1-[4-(5,5,5-trifluoropentyl)phenyl]ethylidene]propane-2-sulfinamide (PubChem CID 154506647) has the molecular formula C17H21F6NOS and a molecular weight of 401.42 g/mol. Its IUPAC name is (S)-2-methyl-N-[2,2,2-trifluoro-1-[4-(5,5,5-trifluoropentyl)phenyl]ethylidene]propane-2-sulfinamide.
| Compound Name | (S)-2-methyl-N-[2,2,2-trifluoro-1-[4-(5,5,5-trifluoropentyl)phenyl]ethylidene]propane-2-sulfinamide |
|---|---|
| PubChem CID | 154506647 |
| Molecular Formula | C17H21F6NOS |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | (S)-2-methyl-N-[2,2,2-trifluoro-1-[4-(5,5,5-trifluoropentyl)phenyl]ethylidene]propane-2-sulfinamide |
| SMILES | CC(C)(C)[S@](=O)N=C(c1ccc(CCCCC(F)(F)F)cc1)C(F)(F)F |
| InChI | InChI=1S/C17H21F6NOS/c1-15(2,3)26(25)24-14(17(21,22)23)13-9-7-12(8-10-13)6-4-5-11-16(18,19)20/h7-10H,4-6,11H2,1-3H3/t26-/m0/s1 |
| InChIKey | JHKYQPCINCIZON-SANMLTNESA-N |
| XLogP | 5.78 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|