C17H22F3NO — CID 150888891
1-isocyanato-4-(10,10,10-trifluorodecyl)benzene (PubChem CID 150888891) has the molecular formula C17H22F3NO and a molecular weight of 313.36 g/mol. Its IUPAC name is 1-isocyanato-4-(10,10,10-trifluorodecyl)benzene.
| Compound Name | 1-isocyanato-4-(10,10,10-trifluorodecyl)benzene |
|---|---|
| PubChem CID | 150888891 |
| Molecular Formula | C17H22F3NO |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | 1-isocyanato-4-(10,10,10-trifluorodecyl)benzene |
| SMILES | O=C=Nc1ccc(CCCCCCCCCC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H22F3NO/c18-17(19,20)13-7-5-3-1-2-4-6-8-15-9-11-16(12-10-15)21-14-22/h9-12H,1-8,13H2 |
| InChIKey | KXPLHYQBVIQTPJ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|