C27H18N6O6 — CID 102249764
1,3,5-tris[(4-isocyanatophenyl)methyl]-1,3,5-triazinane-2,4,6-trione (PubChem CID 102249764) has the molecular formula C27H18N6O6 and a molecular weight of 522.48 g/mol. Its IUPAC name is 1,3,5-tris[(4-isocyanatophenyl)methyl]-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3,5-tris[(4-isocyanatophenyl)methyl]-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 102249764 |
| Molecular Formula | C27H18N6O6 |
| Molecular Weight | 522.48 g/mol |
| Exact Mass | 522.13 |
| IUPAC Name | 1,3,5-tris[(4-isocyanatophenyl)methyl]-1,3,5-triazinane-2,4,6-trione |
| SMILES | O=C=Nc1ccc(Cn2c(=O)n(Cc3ccc(N=C=O)cc3)c(=O)n(Cc3ccc(N=C=O)cc3)c2=O)cc1 |
| InChI | InChI=1S/C27H18N6O6/c34-16-28-22-7-1-19(2-8-22)13-31-25(37)32(14-20-3-9-23(10-4-20)29-17-35)27(39)33(26(31)38)15-21-5-11-24(12-6-21)30-18-36/h1-12H,13-15H2 |
| InChIKey | JEYWTNPAGBDYFG-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 154.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.48 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|