C18H15N3O3 — CID 174974366
1-isocyanato-4-[(4-isocyanatophenyl)methyl]benzene;prop-2-enamide (PubChem CID 174974366) has the molecular formula C18H15N3O3 and a molecular weight of 321.34 g/mol. Its IUPAC name is 1-isocyanato-4-[(4-isocyanatophenyl)methyl]benzene;prop-2-enamide.
| Compound Name | 1-isocyanato-4-[(4-isocyanatophenyl)methyl]benzene;prop-2-enamide |
|---|---|
| PubChem CID | 174974366 |
| Molecular Formula | C18H15N3O3 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 1-isocyanato-4-[(4-isocyanatophenyl)methyl]benzene;prop-2-enamide |
| SMILES | C=CC(N)=O.O=C=Nc1ccc(Cc2ccc(N=C=O)cc2)cc1 |
| InChI | InChI=1S/C15H10N2O2.C3H5NO/c18-10-16-14-5-1-12(2-6-14)9-13-3-7-15(8-4-13)17-11-19;1-2-3(4)5/h1-8H,9H2;2H,1H2,(H2,4,5) |
| InChIKey | DBBLZLBMGSUCBV-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 101.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|