C23H16N3O3- — CID 21477409
1,2-bis[(4-isocyanatophenyl)methyl]benzene isocyanate (PubChem CID 21477409) has the molecular formula C23H16N3O3- and a molecular weight of 382.40 g/mol. Its IUPAC name is 1,2-bis[(4-isocyanatophenyl)methyl]benzene isocyanate.
| Compound Name | 1,2-bis[(4-isocyanatophenyl)methyl]benzene isocyanate |
|---|---|
| PubChem CID | 21477409 |
| Molecular Formula | C23H16N3O3- |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 1,2-bis[(4-isocyanatophenyl)methyl]benzene isocyanate |
| SMILES | O=C=Nc1ccc(Cc2ccccc2Cc2ccc(N=C=O)cc2)cc1.[N-]=C=O |
| InChI | InChI=1S/C22H16N2O2.CNO/c25-15-23-21-9-5-17(6-10-21)13-19-3-1-2-4-20(19)14-18-7-11-22(12-8-18)24-16-26;2-1-3/h1-12H,13-14H2;/q;-1 |
| InChIKey | QWTFZZVBRIRXPM-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 98.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|