1,2-bis[(4-isocyanatophenyl)methyl]benzene isocyanate

C23H16N3O3- — CID 21477409

IUPAC1,2-bis[(4-isocyanatophenyl)methyl]benzene isocyanate
SMILESO=C=Nc1ccc(Cc2ccccc2Cc2ccc(N=C=O)cc2)cc1.[N-]=C=O
InChIInChI=1S/C22H16N2O2.CNO/c25-15-23-21-9-5-17(6-10-21)13-19-3-1-2-4-20(19)14-18-7-11-22(12-8-18)24-16-26;2-1-3/h1-12H,13-14H2;/q;-1
InChIKeyQWTFZZVBRIRXPM-UHFFFAOYSA-N
MW382.40 g/mol
LogP4.69
Rot. Bonds6

About 1,2-bis[(4-isocyanatophenyl)methyl]benzene isocyanate

1,2-bis[(4-isocyanatophenyl)methyl]benzene isocyanate (PubChem CID 21477409) has the molecular formula C23H16N3O3- and a molecular weight of 382.40 g/mol. Its IUPAC name is 1,2-bis[(4-isocyanatophenyl)methyl]benzene isocyanate.

Molecular Properties

Compound Name1,2-bis[(4-isocyanatophenyl)methyl]benzene isocyanate
PubChem CID21477409
Molecular FormulaC23H16N3O3-
Molecular Weight382.40 g/mol
Exact Mass382.12
IUPAC Name1,2-bis[(4-isocyanatophenyl)methyl]benzene isocyanate
SMILESO=C=Nc1ccc(Cc2ccccc2Cc2ccc(N=C=O)cc2)cc1.[N-]=C=O
InChIInChI=1S/C22H16N2O2.CNO/c25-15-23-21-9-5-17(6-10-21)13-19-3-1-2-4-20(19)14-18-7-11-22(12-8-18)24-16-26;2-1-3/h1-12H,13-14H2;/q;-1
InChIKeyQWTFZZVBRIRXPM-UHFFFAOYSA-N
XLogP4.69
TPSA98.23 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms29
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500382.40
LogP ≤ 54.69
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}

Analyze 1,2-bis[(4-isocyanatophenyl)methyl]benzene isocyanate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,2-bis[(4-isocyanatophenyl)methyl]benzene isocyanate?
The IUPAC name of 1,2-bis[(4-isocyanatophenyl)methyl]benzene isocyanate (CID 21477409) is 1,2-bis[(4-isocyanatophenyl)methyl]benzene isocyanate.
What is the SMILES notation for 1,2-bis[(4-isocyanatophenyl)methyl]benzene isocyanate?
The canonical SMILES for 1,2-bis[(4-isocyanatophenyl)methyl]benzene isocyanate is O=C=Nc1ccc(Cc2ccccc2Cc2ccc(N=C=O)cc2)cc1.[N-]=C=O.
What is the InChIKey of 1,2-bis[(4-isocyanatophenyl)methyl]benzene isocyanate?
The InChIKey is QWTFZZVBRIRXPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16N2O2.CNO/c25-15-23-21-9-5-17(6-10-21)13-19-3-1-2-4-20(19)14-18-7-11-22(12-8-18)24-16-26;2-1-3/h1-12H,13-14H2;/q;-1.
What are the key properties of 1,2-bis[(4-isocyanatophenyl)methyl]benzene isocyanate?
1,2-bis[(4-isocyanatophenyl)methyl]benzene isocyanate has a molecular weight of 382.40 g/mol, XLogP of 4.69, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-bis[(4-isocyanatophenyl)methyl]benzene isocyanate is sourced from PubChem (CID 21477409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).