C15H14N2O2 — CID 20588288
[4-[(4-isocyanatophenyl)methyl]anilino]methanol (PubChem CID 20588288) has the molecular formula C15H14N2O2 and a molecular weight of 254.29 g/mol. Its IUPAC name is [4-[(4-isocyanatophenyl)methyl]anilino]methanol.
| Compound Name | [4-[(4-isocyanatophenyl)methyl]anilino]methanol |
|---|---|
| PubChem CID | 20588288 |
| Molecular Formula | C15H14N2O2 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | [4-[(4-isocyanatophenyl)methyl]anilino]methanol |
| SMILES | O=C=Nc1ccc(Cc2ccc(NCO)cc2)cc1 |
| InChI | InChI=1S/C15H14N2O2/c18-10-16-14-5-1-12(2-6-14)9-13-3-7-15(8-4-13)17-11-19/h1-8,16,18H,9-10H2 |
| InChIKey | VQFSZMQMKCCFKR-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|