C42H32N4O8 — CID 89308837
[3-[[4-[(4-isocyanatophenyl)methyl]phenyl]carbamoyloxy]phenyl] N-[4-[[4-[(3-hydroxyphenoxy)carbonylamino]phenyl]methyl]phenyl]carbamate (PubChem CID 89308837) has the molecular formula C42H32N4O8 and a molecular weight of 720.74 g/mol. Its IUPAC name is [3-[[4-[(4-isocyanatophenyl)methyl]phenyl]carbamoyloxy]phenyl] N-[4-[[4-[(3-hydroxyphenoxy)carbonylamino]phenyl]methyl]phenyl]carbamate.
| Compound Name | [3-[[4-[(4-isocyanatophenyl)methyl]phenyl]carbamoyloxy]phenyl] N-[4-[[4-[(3-hydroxyphenoxy)carbonylamino]phenyl]methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 89308837 |
| Molecular Formula | C42H32N4O8 |
| Molecular Weight | 720.74 g/mol |
| Exact Mass | 720.22 |
| IUPAC Name | [3-[[4-[(4-isocyanatophenyl)methyl]phenyl]carbamoyloxy]phenyl] N-[4-[[4-[(3-hydroxyphenoxy)carbonylamino]phenyl]methyl]phenyl]carbamate |
| SMILES | O=C=Nc1ccc(Cc2ccc(NC(=O)Oc3cccc(OC(=O)Nc4ccc(Cc5ccc(NC(=O)Oc6cccc(O)c6)cc5)cc4)c3)cc2)cc1 |
| InChI | InChI=1S/C42H32N4O8/c47-27-43-32-15-7-28(8-16-32)23-29-9-19-34(20-10-29)45-41(50)53-38-5-2-6-39(26-38)54-42(51)46-35-21-13-31(14-22-35)24-30-11-17-33(18-12-30)44-40(49)52-37-4-1-3-36(48)25-37/h1-22,25-26,48H,23-24H2,(H,44,49)(H,45,50)(H,46,51) |
| InChIKey | ZLHBTQNPAKMBOR-UHFFFAOYSA-N |
| XLogP | 9.37 |
| TPSA | 164.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.74 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|