C38H38N4O7 — CID 20730777
4-[4-[[4-[(4-isocyanatophenyl)methyl]phenyl]carbamoyloxy]butoxy]butyl N-[4-[(4-isocyanatophenyl)methyl]phenyl]carbamate (PubChem CID 20730777) has the molecular formula C38H38N4O7 and a molecular weight of 662.74 g/mol. Its IUPAC name is 4-[4-[[4-[(4-isocyanatophenyl)methyl]phenyl]carbamoyloxy]butoxy]butyl N-[4-[(4-isocyanatophenyl)methyl]phenyl]carbamate.
| Compound Name | 4-[4-[[4-[(4-isocyanatophenyl)methyl]phenyl]carbamoyloxy]butoxy]butyl N-[4-[(4-isocyanatophenyl)methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 20730777 |
| Molecular Formula | C38H38N4O7 |
| Molecular Weight | 662.74 g/mol |
| Exact Mass | 662.27 |
| IUPAC Name | 4-[4-[[4-[(4-isocyanatophenyl)methyl]phenyl]carbamoyloxy]butoxy]butyl N-[4-[(4-isocyanatophenyl)methyl]phenyl]carbamate |
| SMILES | O=C=Nc1ccc(Cc2ccc(NC(=O)OCCCCOCCCCOC(=O)Nc3ccc(Cc4ccc(N=C=O)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C38H38N4O7/c43-27-39-33-13-5-29(6-14-33)25-31-9-17-35(18-10-31)41-37(45)48-23-3-1-21-47-22-2-4-24-49-38(46)42-36-19-11-32(12-20-36)26-30-7-15-34(16-8-30)40-28-44/h5-20H,1-4,21-26H2,(H,41,45)(H,42,46) |
| InChIKey | QKECPGORKCYPEZ-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 144.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.74 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|