C24H30N2O4 — CID 130347169
[2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl] N-[4-[(4-isocyanatophenyl)methyl]phenyl]carbamate (PubChem CID 130347169) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is [2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl] N-[4-[(4-isocyanatophenyl)methyl]phenyl]carbamate.
| Compound Name | [2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl] N-[4-[(4-isocyanatophenyl)methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 130347169 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | [2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl] N-[4-[(4-isocyanatophenyl)methyl]phenyl]carbamate |
| SMILES | CC(C)(C)OCCC(C)(C)OC(=O)Nc1ccc(Cc2ccc(N=C=O)cc2)cc1 |
| InChI | InChI=1S/C24H30N2O4/c1-23(2,3)29-15-14-24(4,5)30-22(28)26-21-12-8-19(9-13-21)16-18-6-10-20(11-7-18)25-17-27/h6-13H,14-16H2,1-5H3,(H,26,28) |
| InChIKey | JUNPIWOZHJFJDH-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|