C31H48N2O2 — CID 145243774
2,7,7,11,11-pentamethyldodecan-2-yl N-[4-[(4-aminophenyl)methyl]phenyl]carbamate (PubChem CID 145243774) has the molecular formula C31H48N2O2 and a molecular weight of 480.74 g/mol. Its IUPAC name is 2,7,7,11,11-pentamethyldodecan-2-yl N-[4-[(4-aminophenyl)methyl]phenyl]carbamate.
| Compound Name | 2,7,7,11,11-pentamethyldodecan-2-yl N-[4-[(4-aminophenyl)methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 145243774 |
| Molecular Formula | C31H48N2O2 |
| Molecular Weight | 480.74 g/mol |
| Exact Mass | 480.37 |
| IUPAC Name | 2,7,7,11,11-pentamethyldodecan-2-yl N-[4-[(4-aminophenyl)methyl]phenyl]carbamate |
| SMILES | CC(C)(C)CCCC(C)(C)CCCCC(C)(C)OC(=O)Nc1ccc(Cc2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C31H48N2O2/c1-29(2,3)19-10-21-30(4,5)20-8-9-22-31(6,7)35-28(34)33-27-17-13-25(14-18-27)23-24-11-15-26(32)16-12-24/h11-18H,8-10,19-23,32H2,1-7H3,(H,33,34) |
| InChIKey | JYGUYLUDEGAUSP-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.74 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|