C15H23NO2S — CID 174196427
5,5-dimethylhexyl N-(4-sulfanylphenyl)carbamate (PubChem CID 174196427) has the molecular formula C15H23NO2S and a molecular weight of 281.42 g/mol. Its IUPAC name is 5,5-dimethylhexyl N-(4-sulfanylphenyl)carbamate.
| Compound Name | 5,5-dimethylhexyl N-(4-sulfanylphenyl)carbamate |
|---|---|
| PubChem CID | 174196427 |
| Molecular Formula | C15H23NO2S |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 5,5-dimethylhexyl N-(4-sulfanylphenyl)carbamate |
| SMILES | CC(C)(C)CCCCOC(=O)Nc1ccc(S)cc1 |
| InChI | InChI=1S/C15H23NO2S/c1-15(2,3)10-4-5-11-18-14(17)16-12-6-8-13(19)9-7-12/h6-9,19H,4-5,10-11H2,1-3H3,(H,16,17) |
| InChIKey | VZWRVLKQUADMQU-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|