C33H28N4O6 — CID 58098525
3-[[4-[(4-isocyanatophenyl)methyl]phenyl]carbamoyloxy]propyl N-[4-[(4-cyanatophenyl)methyl]phenyl]carbamate (PubChem CID 58098525) has the molecular formula C33H28N4O6 and a molecular weight of 576.61 g/mol. Its IUPAC name is 3-[[4-[(4-isocyanatophenyl)methyl]phenyl]carbamoyloxy]propyl N-[4-[(4-cyanatophenyl)methyl]phenyl]carbamate.
| Compound Name | 3-[[4-[(4-isocyanatophenyl)methyl]phenyl]carbamoyloxy]propyl N-[4-[(4-cyanatophenyl)methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 58098525 |
| Molecular Formula | C33H28N4O6 |
| Molecular Weight | 576.61 g/mol |
| Exact Mass | 576.20 |
| IUPAC Name | 3-[[4-[(4-isocyanatophenyl)methyl]phenyl]carbamoyloxy]propyl N-[4-[(4-cyanatophenyl)methyl]phenyl]carbamate |
| SMILES | N#COc1ccc(Cc2ccc(NC(=O)OCCCOC(=O)Nc3ccc(Cc4ccc(N=C=O)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C33H28N4O6/c34-22-43-31-16-8-27(9-17-31)21-26-6-14-30(15-7-26)37-33(40)42-19-1-18-41-32(39)36-29-12-4-25(5-13-29)20-24-2-10-28(11-3-24)35-23-38/h2-17H,1,18-21H2,(H,36,39)(H,37,40) |
| InChIKey | QSVFCDKYPZCMHZ-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 139.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.61 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|