C24H28N3O4 — CID 59112165
CID 59112165 (PubChem CID 59112165) has the molecular formula C24H28N3O4 and a molecular weight of 422.51 g/mol.
| Compound Name | CID 59112165 |
|---|---|
| PubChem CID | 59112165 |
| Molecular Formula | C24H28N3O4 |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | — |
| SMILES | CC1(C)CC(OC(=O)Nc2ccc(Cc3ccc(N=C=O)cc3)cc2)CC(C)(C)N1[O] |
| InChI | InChI=1S/C24H28N3O4/c1-23(2)14-21(15-24(3,4)27(23)30)31-22(29)26-20-11-7-18(8-12-20)13-17-5-9-19(10-6-17)25-16-28/h5-12,21H,13-15H2,1-4H3,(H,26,29) |
| InChIKey | ACRSIOGJVUKRJN-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|