C23H22N2O8 — CID 58924761
[4-(4-isocyanatophenyl)-4-oxobutyl] 4-(2-acetyloxyethoxycarbonylamino)benzoate (PubChem CID 58924761) has the molecular formula C23H22N2O8 and a molecular weight of 454.44 g/mol. Its IUPAC name is [4-(4-isocyanatophenyl)-4-oxobutyl] 4-(2-acetyloxyethoxycarbonylamino)benzoate.
| Compound Name | [4-(4-isocyanatophenyl)-4-oxobutyl] 4-(2-acetyloxyethoxycarbonylamino)benzoate |
|---|---|
| PubChem CID | 58924761 |
| Molecular Formula | C23H22N2O8 |
| Molecular Weight | 454.44 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | [4-(4-isocyanatophenyl)-4-oxobutyl] 4-(2-acetyloxyethoxycarbonylamino)benzoate |
| SMILES | CC(=O)OCCOC(=O)Nc1ccc(C(=O)OCCCC(=O)c2ccc(N=C=O)cc2)cc1 |
| InChI | InChI=1S/C23H22N2O8/c1-16(27)31-13-14-33-23(30)25-20-10-6-18(7-11-20)22(29)32-12-2-3-21(28)17-4-8-19(9-5-17)24-15-26/h4-11H,2-3,12-14H2,1H3,(H,25,30) |
| InChIKey | IMJZSXLPIPDXSH-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 137.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.44 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|