C20H17FN2O4 — CID 7808333
[4-(4-fluorophenyl)-4-oxobutyl] 4-[(2-cyanoacetyl)amino]benzoate (PubChem CID 7808333) has the molecular formula C20H17FN2O4 and a molecular weight of 368.36 g/mol. Its IUPAC name is [4-(4-fluorophenyl)-4-oxobutyl] 4-[(2-cyanoacetyl)amino]benzoate.
| Compound Name | [4-(4-fluorophenyl)-4-oxobutyl] 4-[(2-cyanoacetyl)amino]benzoate |
|---|---|
| PubChem CID | 7808333 |
| Molecular Formula | C20H17FN2O4 |
| Molecular Weight | 368.36 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | [4-(4-fluorophenyl)-4-oxobutyl] 4-[(2-cyanoacetyl)amino]benzoate |
| SMILES | N#CCC(=O)Nc1ccc(C(=O)OCCCC(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C20H17FN2O4/c21-16-7-3-14(4-8-16)18(24)2-1-13-27-20(26)15-5-9-17(10-6-15)23-19(25)11-12-22/h3-10H,1-2,11,13H2,(H,23,25) |
| InChIKey | UIJRCGXPIHYIIT-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.36 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|