C15H21ClF3N — CID 152535807
2-chloro-5-(10,10,10-trifluorodecyl)pyridine (PubChem CID 152535807) has the molecular formula C15H21ClF3N and a molecular weight of 307.79 g/mol. Its IUPAC name is 2-chloro-5-(10,10,10-trifluorodecyl)pyridine.
| Compound Name | 2-chloro-5-(10,10,10-trifluorodecyl)pyridine |
|---|---|
| PubChem CID | 152535807 |
| Molecular Formula | C15H21ClF3N |
| Molecular Weight | 307.79 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 2-chloro-5-(10,10,10-trifluorodecyl)pyridine |
| SMILES | FC(F)(F)CCCCCCCCCc1ccc(Cl)nc1 |
| InChI | InChI=1S/C15H21ClF3N/c16-14-10-9-13(12-20-14)8-6-4-2-1-3-5-7-11-15(17,18)19/h9-10,12H,1-8,11H2 |
| InChIKey | YKMPWRSLWRHZCC-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.79 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|