C16H44ClN5O12S4 — CID 139621052
triazanium;7-(6-chloro-3-pyridinyl)heptylazanium;methanesulfonate (PubChem CID 139621052) has the molecular formula C16H44ClN5O12S4 and a molecular weight of 662.27 g/mol. Its IUPAC name is triazanium;7-(6-chloro-3-pyridinyl)heptylazanium;methanesulfonate.
| Compound Name | triazanium;7-(6-chloro-3-pyridinyl)heptylazanium;methanesulfonate |
|---|---|
| PubChem CID | 139621052 |
| Molecular Formula | C16H44ClN5O12S4 |
| Molecular Weight | 662.27 g/mol |
| Exact Mass | 661.16 |
| IUPAC Name | triazanium;7-(6-chloro-3-pyridinyl)heptylazanium;methanesulfonate |
| SMILES | CS(=O)(=O)[O-].CS(=O)(=O)[O-].CS(=O)(=O)[O-].CS(=O)(=O)[O-].[NH3+]CCCCCCCc1ccc(Cl)nc1.[NH4+].[NH4+].[NH4+] |
| InChI | InChI=1S/C12H19ClN2.4CH4O3S.3H3N/c13-12-8-7-11(10-15-12)6-4-2-1-3-5-9-14;4*1-5(2,3)4;;;/h7-8,10H,1-6,9,14H2;4*1H3,(H,2,3,4);3*1H3 |
| InChIKey | UEPRQMLSDZHBGC-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 378.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.27 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|