C14H19ClN2O3 — CID 123511597
5-[4-(6-chloro-3-pyridinyl)butylamino]-5-oxopentanoic acid (PubChem CID 123511597) has the molecular formula C14H19ClN2O3 and a molecular weight of 298.77 g/mol. Its IUPAC name is 5-[4-(6-chloro-3-pyridinyl)butylamino]-5-oxopentanoic acid.
| Compound Name | 5-[4-(6-chloro-3-pyridinyl)butylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 123511597 |
| Molecular Formula | C14H19ClN2O3 |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 5-[4-(6-chloro-3-pyridinyl)butylamino]-5-oxopentanoic acid |
| SMILES | O=C(O)CCCC(=O)NCCCCc1ccc(Cl)nc1 |
| InChI | InChI=1S/C14H19ClN2O3/c15-12-8-7-11(10-17-12)4-1-2-9-16-13(18)5-3-6-14(19)20/h7-8,10H,1-6,9H2,(H,16,18)(H,19,20) |
| InChIKey | RNNRZNIGYIZHSE-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|