C15H25ClN4O2S — CID 109390978
1-[2-(6-chloro-3-pyridinyl)ethyl]-3-ethyl-2-(2-methyl-2-methylsulfonylpropyl)guanidine (PubChem CID 109390978) has the molecular formula C15H25ClN4O2S and a molecular weight of 360.91 g/mol. Its IUPAC name is 1-[2-(6-chloro-3-pyridinyl)ethyl]-3-ethyl-2-(2-methyl-2-methylsulfonylpropyl)guanidine.
| Compound Name | 1-[2-(6-chloro-3-pyridinyl)ethyl]-3-ethyl-2-(2-methyl-2-methylsulfonylpropyl)guanidine |
|---|---|
| PubChem CID | 109390978 |
| Molecular Formula | C15H25ClN4O2S |
| Molecular Weight | 360.91 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 1-[2-(6-chloro-3-pyridinyl)ethyl]-3-ethyl-2-(2-methyl-2-methylsulfonylpropyl)guanidine |
| SMILES | CCN/C(=N\CC(C)(C)S(C)(=O)=O)NCCc1ccc(Cl)nc1 |
| InChI | InChI=1S/C15H25ClN4O2S/c1-5-17-14(20-11-15(2,3)23(4,21)22)18-9-8-12-6-7-13(16)19-10-12/h6-7,10H,5,8-9,11H2,1-4H3,(H2,17,18,20) |
| InChIKey | YFXZLYVSFYRONH-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.91 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|