About 2-[2-(6-chloro-3-pyridinyl)ethyl]-1-imino-3,4-dimethyl-3H-1,2-thiazole
2-[2-(6-chloro-3-pyridinyl)ethyl]-1-imino-3,4-dimethyl-3H-1,2-thiazole (PubChem CID 151454471) has the molecular formula C12H16ClN3S
and a molecular weight of 269.80 g/mol. Its IUPAC name is 2-[2-(6-chloro-3-pyridinyl)ethyl]-1-imino-3,4-dimethyl-3H-1,2-thiazole.
Molecular Properties
| Compound Name | 2-[2-(6-chloro-3-pyridinyl)ethyl]-1-imino-3,4-dimethyl-3H-1,2-thiazole |
| PubChem CID | 151454471 |
| Molecular Formula | C12H16ClN3S |
| Molecular Weight | 269.80 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 2-[2-(6-chloro-3-pyridinyl)ethyl]-1-imino-3,4-dimethyl-3H-1,2-thiazole |
| SMILES | [H]/N=S1\C=C(C)C(C)N1CCc1ccc(Cl)nc1 |
| InChI | InChI=1S/C12H16ClN3S/c1-9-8-17(14)16(10(9)2)6-5-11-3-4-12(13)15-7-11/h3-4,7-8,10,14H,5-6H2,1-2H3 |
| InChIKey | PHDUJOSXHLNZBL-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 39.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.80 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(6-chloro-3-pyridinyl)ethyl]-1-imino-3,4-dimethyl-3H-1,2-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(6-chloro-3-pyridinyl)ethyl]-1-imino-3,4-dimethyl-3H-1,2-thiazole?
The IUPAC name of 2-[2-(6-chloro-3-pyridinyl)ethyl]-1-imino-3,4-dimethyl-3H-1,2-thiazole (CID 151454471) is 2-[2-(6-chloro-3-pyridinyl)ethyl]-1-imino-3,4-dimethyl-3H-1,2-thiazole.
What is the SMILES notation for 2-[2-(6-chloro-3-pyridinyl)ethyl]-1-imino-3,4-dimethyl-3H-1,2-thiazole?
The canonical SMILES for 2-[2-(6-chloro-3-pyridinyl)ethyl]-1-imino-3,4-dimethyl-3H-1,2-thiazole is [H]/N=S1\C=C(C)C(C)N1CCc1ccc(Cl)nc1.
What is the InChIKey of 2-[2-(6-chloro-3-pyridinyl)ethyl]-1-imino-3,4-dimethyl-3H-1,2-thiazole?
The InChIKey is PHDUJOSXHLNZBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16ClN3S/c1-9-8-17(14)16(10(9)2)6-5-11-3-4-12(13)15-7-11/h3-4,7-8,10,14H,5-6H2,1-2H3.
What are the key properties of 2-[2-(6-chloro-3-pyridinyl)ethyl]-1-imino-3,4-dimethyl-3H-1,2-thiazole?
2-[2-(6-chloro-3-pyridinyl)ethyl]-1-imino-3,4-dimethyl-3H-1,2-thiazole has a molecular weight of 269.80 g/mol, XLogP of 3.18, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(6-chloro-3-pyridinyl)ethyl]-1-imino-3,4-dimethyl-3H-1,2-thiazole is sourced from PubChem (CID 151454471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).