C15H14Cl2N4S — CID 154239330
3-(6-chloro-3-pyridinyl)-2-[(6-chloro-3-pyridinyl)methyl]-1-imino-2-methyl-1,3-thiazole (PubChem CID 154239330) has the molecular formula C15H14Cl2N4S and a molecular weight of 353.28 g/mol. Its IUPAC name is 3-(6-chloro-3-pyridinyl)-2-[(6-chloro-3-pyridinyl)methyl]-1-imino-2-methyl-1,3-thiazole.
| Compound Name | 3-(6-chloro-3-pyridinyl)-2-[(6-chloro-3-pyridinyl)methyl]-1-imino-2-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 154239330 |
| Molecular Formula | C15H14Cl2N4S |
| Molecular Weight | 353.28 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | 3-(6-chloro-3-pyridinyl)-2-[(6-chloro-3-pyridinyl)methyl]-1-imino-2-methyl-1,3-thiazole |
| SMILES | [H]/N=S1\C=CN(c2ccc(Cl)nc2)C1(C)Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C15H14Cl2N4S/c1-15(8-11-2-4-13(16)19-9-11)21(6-7-22(15)18)12-3-5-14(17)20-10-12/h2-7,9-10,18H,8H2,1H3 |
| InChIKey | IVHJISXKKLLTLX-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 52.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.28 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|